C15H18FN3 — CID 89331468
(1Z,3Z)-3-[2-(4-fluorophenyl)-2-(methylhydrazinylidene)ethyl]hexa-1,3,5-trien-1-amine (PubChem CID 89331468) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is (1Z,3Z)-3-[2-(4-fluorophenyl)-2-(methylhydrazinylidene)ethyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-[2-(4-fluorophenyl)-2-(methylhydrazinylidene)ethyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89331468 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | (1Z,3Z)-3-[2-(4-fluorophenyl)-2-(methylhydrazinylidene)ethyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)CC(=NNC)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN3/c1-3-4-12(9-10-17)11-15(19-18-2)13-5-7-14(16)8-6-13/h3-10,18H,1,11,17H2,2H3/b10-9-,12-4+,19-15? |
| InChIKey | VSHPHJDWJFLPJO-BWKBVLSRSA-N |
| XLogP | 2.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|