C18H23N3 — CID 89331513
(1Z,3E)-3-[(1E)-1-[amino(methyl)amino]-3-methyl-1-phenylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine (PubChem CID 89331513) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (1Z,3E)-3-[(1E)-1-[amino(methyl)amino]-3-methyl-1-phenylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-[(1E)-1-[amino(methyl)amino]-3-methyl-1-phenylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89331513 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | (1Z,3E)-3-[(1E)-1-[amino(methyl)amino]-3-methyl-1-phenylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)C(/C(=C)C)=C(\c1ccccc1)N(C)N |
| InChI | InChI=1S/C18H23N3/c1-5-9-15(12-13-19)17(14(2)3)18(21(4)20)16-10-7-6-8-11-16/h5-13H,1-2,19-20H2,3-4H3/b13-12-,15-9+,18-17+ |
| InChIKey | WLKNVDQTHAMXEQ-OUCZOBOPSA-N |
| XLogP | 3.36 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|