C17H27N3 — CID 89331539
(1Z,3E)-3-[(1E)-1-cyclohexyl-1-hydrazinyl-3-methylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine (PubChem CID 89331539) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (1Z,3E)-3-[(1E)-1-cyclohexyl-1-hydrazinyl-3-methylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-[(1E)-1-cyclohexyl-1-hydrazinyl-3-methylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89331539 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (1Z,3E)-3-[(1E)-1-cyclohexyl-1-hydrazinyl-3-methylbuta-1,3-dien-2-yl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)C(/C(=C)C)=C(/NN)C1CCCCC1 |
| InChI | InChI=1S/C17H27N3/c1-4-8-14(11-12-18)16(13(2)3)17(20-19)15-9-6-5-7-10-15/h4,8,11-12,15,20H,1-2,5-7,9-10,18-19H2,3H3/b12-11-,14-8+,17-16+ |
| InChIKey | PSACGTADXUQTNI-KVVJCVRCSA-N |
| XLogP | 3.44 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|