2,3,4,5-tetrafluoro-6-formylbenzoic acid

C8H2F4O3 — CID 89331543

IUPAC2,3,4,5-tetrafluoro-6-formylbenzoic acid
SMILESO=Cc1c(F)c(F)c(F)c(F)c1C(=O)O
InChIInChI=1S/C8H2F4O3/c9-4-2(1-13)3(8(14)15)5(10)7(12)6(4)11/h1H,(H,14,15)
InChIKeyRVUGXXVAYKFCIT-UHFFFAOYSA-N
MW222.09 g/mol
LogP1.75
Rot. Bonds2

About 2,3,4,5-tetrafluoro-6-formylbenzoic acid

2,3,4,5-tetrafluoro-6-formylbenzoic acid (PubChem CID 89331543) has the molecular formula C8H2F4O3 and a molecular weight of 222.09 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-formylbenzoic acid.

Molecular Properties

Compound Name2,3,4,5-tetrafluoro-6-formylbenzoic acid
PubChem CID89331543
Molecular FormulaC8H2F4O3
Molecular Weight222.09 g/mol
Exact Mass221.99
IUPAC Name2,3,4,5-tetrafluoro-6-formylbenzoic acid
SMILESO=Cc1c(F)c(F)c(F)c(F)c1C(=O)O
InChIInChI=1S/C8H2F4O3/c9-4-2(1-13)3(8(14)15)5(10)7(12)6(4)11/h1H,(H,14,15)
InChIKeyRVUGXXVAYKFCIT-UHFFFAOYSA-N
XLogP1.75
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.09
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2,3,4,5-tetrafluoro-6-formylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,4,5-tetrafluoro-6-formylbenzoic acid?
The IUPAC name of 2,3,4,5-tetrafluoro-6-formylbenzoic acid (CID 89331543) is 2,3,4,5-tetrafluoro-6-formylbenzoic acid.
What is the SMILES notation for 2,3,4,5-tetrafluoro-6-formylbenzoic acid?
The canonical SMILES for 2,3,4,5-tetrafluoro-6-formylbenzoic acid is O=Cc1c(F)c(F)c(F)c(F)c1C(=O)O.
What is the InChIKey of 2,3,4,5-tetrafluoro-6-formylbenzoic acid?
The InChIKey is RVUGXXVAYKFCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F4O3/c9-4-2(1-13)3(8(14)15)5(10)7(12)6(4)11/h1H,(H,14,15).
What are the key properties of 2,3,4,5-tetrafluoro-6-formylbenzoic acid?
2,3,4,5-tetrafluoro-6-formylbenzoic acid has a molecular weight of 222.09 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrafluoro-6-formylbenzoic acid is sourced from PubChem (CID 89331543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).