C22H28FN5O — CID 89331595
4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1H-pyrazol-3-amine (PubChem CID 89331595) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1H-pyrazol-3-amine.
| Compound Name | 4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 89331595 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 4-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(4-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1H-pyrazol-3-amine |
| SMILES | C=C/C=C(\C=C/N)c1c(NCCCN2CCOCC2)n[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN5O/c1-2-4-17(9-10-24)20-21(18-5-7-19(23)8-6-18)26-27-22(20)25-11-3-12-28-13-15-29-16-14-28/h2,4-10H,1,3,11-16,24H2,(H2,25,26,27)/b10-9-,17-4+ |
| InChIKey | ZCUYGESJNUETSV-MKTOCWHVSA-N |
| XLogP | 3.39 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|