C21H26FN5O — CID 89331642
(3Z,4E)-4-[(Z)-2-aminoethenyl]-3-[(4-fluorophenyl)-hydrazinylmethylidene]-2-methylidene-1-piperazin-1-ylhepta-4,6-dien-1-one (PubChem CID 89331642) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is (3Z,4E)-4-[(Z)-2-aminoethenyl]-3-[(4-fluorophenyl)-hydrazinylmethylidene]-2-methylidene-1-piperazin-1-ylhepta-4,6-dien-1-one.
| Compound Name | (3Z,4E)-4-[(Z)-2-aminoethenyl]-3-[(4-fluorophenyl)-hydrazinylmethylidene]-2-methylidene-1-piperazin-1-ylhepta-4,6-dien-1-one |
|---|---|
| PubChem CID | 89331642 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (3Z,4E)-4-[(Z)-2-aminoethenyl]-3-[(4-fluorophenyl)-hydrazinylmethylidene]-2-methylidene-1-piperazin-1-ylhepta-4,6-dien-1-one |
| SMILES | C=C/C=C(\C=C/N)C(/C(=C)C(=O)N1CCNCC1)=C(/NN)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN5O/c1-3-4-16(9-10-23)19(15(2)21(28)27-13-11-25-12-14-27)20(26-24)17-5-7-18(22)8-6-17/h3-10,25-26H,1-2,11-14,23-24H2/b10-9-,16-4+,20-19+ |
| InChIKey | FPPWOZTXVURTQD-KFONYAPJSA-N |
| XLogP | 1.57 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|