C15H24N2 — CID 89331657
(1Z,3Z)-3-[2-(piperidin-4-ylmethyl)prop-2-enyl]hexa-1,3,5-trien-1-amine (PubChem CID 89331657) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (1Z,3Z)-3-[2-(piperidin-4-ylmethyl)prop-2-enyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-[2-(piperidin-4-ylmethyl)prop-2-enyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89331657 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (1Z,3Z)-3-[2-(piperidin-4-ylmethyl)prop-2-enyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)CC(=C)CC1CCNCC1 |
| InChI | InChI=1S/C15H24N2/c1-3-4-14(5-8-16)11-13(2)12-15-6-9-17-10-7-15/h3-5,8,15,17H,1-2,6-7,9-12,16H2/b8-5-,14-4+ |
| InChIKey | FPDMOAVJYFBZGK-CQXJEZQLSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|