C30H28N2 — CID 89331818
6-imino-5-methyl-2-(13-methyl-2,3,6,6a-tetrahydropentacen-6-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 89331818) has the molecular formula C30H28N2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 6-imino-5-methyl-2-(13-methyl-2,3,6,6a-tetrahydropentacen-6-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-imino-5-methyl-2-(13-methyl-2,3,6,6a-tetrahydropentacen-6-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89331818 |
| Molecular Formula | C30H28N2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 6-imino-5-methyl-2-(13-methyl-2,3,6,6a-tetrahydropentacen-6-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C1\C(C)=CC=C(C2c3cc4c(cc3C(C)=C3C=c5ccccc5=CC32)=CCCC=4)C1N |
| InChI | InChI=1S/C30H28N2/c1-17-11-12-23(30(32)29(17)31)28-26-15-21-9-5-3-7-19(21)13-24(26)18(2)25-14-20-8-4-6-10-22(20)16-27(25)28/h3,5,7-16,26,28,30-31H,4,6,32H2,1-2H3/b31-29+ |
| InChIKey | LWISFXYNMLVTHI-OWWNRXNESA-N |
| XLogP | 3.04 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|