About 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine
6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 89331862) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 89331862 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | [H]/N=C1\C(C)=CC=C(C)C1N |
| InChI | InChI=1S/C8H12N2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7,10H,9H2,1-2H3/b10-8+ |
| InChIKey | VLAMKDLFTYIEGT-CSKARUKUSA-N |
| XLogP | 1.24 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine (CID 89331862) is 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine is [H]/N=C1\C(C)=CC=C(C)C1N.
What is the InChIKey of 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is VLAMKDLFTYIEGT-CSKARUKUSA-N. The full InChI is InChI=1S/C8H12N2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7,10H,9H2,1-2H3/b10-8+.
What are the key properties of 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine?
6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 136.20 g/mol, XLogP of 1.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2,5-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89331862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).