C23H38N6O2S — CID 89332245
2-[(E)-[(2-ethyl-2,3-dihydrothiophen-5-yl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyrimidin-4-amine (PubChem CID 89332245) has the molecular formula C23H38N6O2S and a molecular weight of 462.66 g/mol. Its IUPAC name is 2-[(E)-[(2-ethyl-2,3-dihydrothiophen-5-yl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyrimidin-4-amine.
| Compound Name | 2-[(E)-[(2-ethyl-2,3-dihydrothiophen-5-yl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 89332245 |
| Molecular Formula | C23H38N6O2S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 2-[(E)-[(2-ethyl-2,3-dihydrothiophen-5-yl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyrimidin-4-amine |
| SMILES | CCCN(CCC)c1cc(OCCN2CCOCC2)nc(/C=N/NC2=CCC(CC)S2)n1 |
| InChI | InChI=1S/C23H38N6O2S/c1-4-9-29(10-5-2)21-17-22(31-16-13-28-11-14-30-15-12-28)26-20(25-21)18-24-27-23-8-7-19(6-3)32-23/h8,17-19,27H,4-7,9-16H2,1-3H3/b24-18+ |
| InChIKey | OHRKOILQUUDDFT-HKOYGPOVSA-N |
| XLogP | 3.49 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|