C30H24N4O5S — CID 89332334
5-[3-(2-hydroxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-isocyanato-N,N-dimethylbenzamide (PubChem CID 89332334) has the molecular formula C30H24N4O5S and a molecular weight of 552.61 g/mol. Its IUPAC name is 5-[3-(2-hydroxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-isocyanato-N,N-dimethylbenzamide.
| Compound Name | 5-[3-(2-hydroxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-isocyanato-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 89332334 |
| Molecular Formula | C30H24N4O5S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 5-[3-(2-hydroxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-2-isocyanato-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccccc3O)c3cc(-c4ccc(N=C=O)c(C(=O)N(C)C)c4)cnc32)cc1 |
| InChI | InChI=1S/C30H24N4O5S/c1-19-8-11-22(12-9-19)40(38,39)34-17-26(23-6-4-5-7-28(23)36)24-15-21(16-31-29(24)34)20-10-13-27(32-18-35)25(14-20)30(37)33(2)3/h4-17,36H,1-3H3 |
| InChIKey | YXZIEPYJRFEJSZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|