About 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one
5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one (PubChem CID 89332455) has the molecular formula C20H20N2O3S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one |
| PubChem CID | 89332455 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one |
| SMILES | C=C1NC(=O)SC1Cc1ccc(OCC(=O)c2ccc(CC)cn2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-3-14-6-9-17(21-11-14)18(23)12-25-16-7-4-15(5-8-16)10-19-13(2)22-20(24)26-19/h4-9,11,19H,2-3,10,12H2,1H3,(H,22,24) |
| InChIKey | BIHOKSLEGAYWIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one?
The IUPAC name of 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one (CID 89332455) is 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one.
What is the SMILES notation for 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one?
The canonical SMILES for 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one is C=C1NC(=O)SC1Cc1ccc(OCC(=O)c2ccc(CC)cn2)cc1.
What is the InChIKey of 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one?
The InChIKey is BIHOKSLEGAYWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3S/c1-3-14-6-9-17(21-11-14)18(23)12-25-16-7-4-15(5-8-16)10-19-13(2)22-20(24)26-19/h4-9,11,19H,2-3,10,12H2,1H3,(H,22,24).
What are the key properties of 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one?
5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one has a molecular weight of 368.46 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[2-(5-ethyl-2-pyridinyl)-2-oxoethoxy]phenyl]methyl]-4-methylidene-1,3-thiazolidin-2-one is sourced from PubChem (CID 89332455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).