About N-(7,7-difluoroheptyl)-N-methylprop-2-enamide
N-(7,7-difluoroheptyl)-N-methylprop-2-enamide (PubChem CID 89332470) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(7,7-difluoroheptyl)-N-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-(7,7-difluoroheptyl)-N-methylprop-2-enamide |
| PubChem CID | 89332470 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(7,7-difluoroheptyl)-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCCCCC(F)F |
| InChI | InChI=1S/C11H19F2NO/c1-3-11(15)14(2)9-7-5-4-6-8-10(12)13/h3,10H,1,4-9H2,2H3 |
| InChIKey | VSILFLZKXVRHQP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(7,7-difluoroheptyl)-N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7-difluoroheptyl)-N-methylprop-2-enamide?
The IUPAC name of N-(7,7-difluoroheptyl)-N-methylprop-2-enamide (CID 89332470) is N-(7,7-difluoroheptyl)-N-methylprop-2-enamide.
What is the SMILES notation for N-(7,7-difluoroheptyl)-N-methylprop-2-enamide?
The canonical SMILES for N-(7,7-difluoroheptyl)-N-methylprop-2-enamide is C=CC(=O)N(C)CCCCCCC(F)F.
What is the InChIKey of N-(7,7-difluoroheptyl)-N-methylprop-2-enamide?
The InChIKey is VSILFLZKXVRHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO/c1-3-11(15)14(2)9-7-5-4-6-8-10(12)13/h3,10H,1,4-9H2,2H3.
What are the key properties of N-(7,7-difluoroheptyl)-N-methylprop-2-enamide?
N-(7,7-difluoroheptyl)-N-methylprop-2-enamide has a molecular weight of 219.27 g/mol, XLogP of 2.85, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7-difluoroheptyl)-N-methylprop-2-enamide is sourced from PubChem (CID 89332470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).