C14H30O4 — CID 89332498
(3R,4S)-2,5-dibutoxy-3-methylpentane-1,4-diol (PubChem CID 89332498) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3R,4S)-2,5-dibutoxy-3-methylpentane-1,4-diol.
| Compound Name | (3R,4S)-2,5-dibutoxy-3-methylpentane-1,4-diol |
|---|---|
| PubChem CID | 89332498 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | (3R,4S)-2,5-dibutoxy-3-methylpentane-1,4-diol |
| SMILES | CCCCOC[C@@H](O)[C@@H](C)C(CO)OCCCC |
| InChI | InChI=1S/C14H30O4/c1-4-6-8-17-11-13(16)12(3)14(10-15)18-9-7-5-2/h12-16H,4-11H2,1-3H3/t12-,13-,14?/m1/s1 |
| InChIKey | KSFKOYKCIXTTHL-ZFXTZCCVSA-N |
| XLogP | 1.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|