About 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one
1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one (PubChem CID 89332546) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one.
Molecular Properties
| Compound Name | 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one |
| PubChem CID | 89332546 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one |
| SMILES | C=C1NC(=O)C(C)=CN1C(O)C[C@H]1OC[C@H]1C |
| InChI | InChI=1S/C12H18N2O3/c1-7-5-14(9(3)13-12(7)16)11(15)4-10-8(2)6-17-10/h5,8,10-11,15H,3-4,6H2,1-2H3,(H,13,16)/t8-,10-,11?/m1/s1 |
| InChIKey | MWKBWCLAXANPGP-TZIJJQLOSA-N |
| XLogP | 0.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one?
The IUPAC name of 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one (CID 89332546) is 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one.
What is the SMILES notation for 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one?
The canonical SMILES for 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one is C=C1NC(=O)C(C)=CN1C(O)C[C@H]1OC[C@H]1C.
What is the InChIKey of 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one?
The InChIKey is MWKBWCLAXANPGP-TZIJJQLOSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-7-5-14(9(3)13-12(7)16)11(15)4-10-8(2)6-17-10/h5,8,10-11,15H,3-4,6H2,1-2H3,(H,13,16)/t8-,10-,11?/m1/s1.
What are the key properties of 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one?
1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one has a molecular weight of 238.29 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-hydroxy-2-[(2R,3R)-3-methyloxetan-2-yl]ethyl]-5-methyl-2-methylidenepyrimidin-4-one is sourced from PubChem (CID 89332546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).