C17H22O — CID 89332701
2,2,6,6-tetramethyl-1,7,8,8a-tetrahydroacenaphthylene-4-carbaldehyde (PubChem CID 89332701) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1,7,8,8a-tetrahydroacenaphthylene-4-carbaldehyde.
| Compound Name | 2,2,6,6-tetramethyl-1,7,8,8a-tetrahydroacenaphthylene-4-carbaldehyde |
|---|---|
| PubChem CID | 89332701 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-1,7,8,8a-tetrahydroacenaphthylene-4-carbaldehyde |
| SMILES | CC1(C)CCC2CC(C)(C)c3cc(C=O)cc1c32 |
| InChI | InChI=1S/C17H22O/c1-16(2)6-5-12-9-17(3,4)14-8-11(10-18)7-13(16)15(12)14/h7-8,10,12H,5-6,9H2,1-4H3 |
| InChIKey | GQELHYVUAQRFBE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|