C9H15NS — CID 89332763
(1E,3Z)-N,N-dimethyl-3-methylsulfanylhexa-1,3,5-trien-1-amine (PubChem CID 89332763) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is (1E,3Z)-N,N-dimethyl-3-methylsulfanylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-N,N-dimethyl-3-methylsulfanylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89332763 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (1E,3Z)-N,N-dimethyl-3-methylsulfanylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(/C=C/N(C)C)SC |
| InChI | InChI=1S/C9H15NS/c1-5-6-9(11-4)7-8-10(2)3/h5-8H,1H2,2-4H3/b8-7+,9-6- |
| InChIKey | OQGDROLZKBQSFQ-NEVGTANLSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|