C32H45ClN6O — CID 89332928
1-(ethylamino)ethenyl 5-[(2R,5S)-4-[1-[1-(4-chlorophenyl)ethenyl]piperidin-4-yl]-5-ethyl-2-methylpiperazin-1-yl]-N,6-dimethylpyridine-2-carboximidate (PubChem CID 89332928) has the molecular formula C32H45ClN6O and a molecular weight of 565.21 g/mol. Its IUPAC name is 1-(ethylamino)ethenyl 5-[(2R,5S)-4-[1-[1-(4-chlorophenyl)ethenyl]piperidin-4-yl]-5-ethyl-2-methylpiperazin-1-yl]-N,6-dimethylpyridine-2-carboximidate.
| Compound Name | 1-(ethylamino)ethenyl 5-[(2R,5S)-4-[1-[1-(4-chlorophenyl)ethenyl]piperidin-4-yl]-5-ethyl-2-methylpiperazin-1-yl]-N,6-dimethylpyridine-2-carboximidate |
|---|---|
| PubChem CID | 89332928 |
| Molecular Formula | C32H45ClN6O |
| Molecular Weight | 565.21 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 1-(ethylamino)ethenyl 5-[(2R,5S)-4-[1-[1-(4-chlorophenyl)ethenyl]piperidin-4-yl]-5-ethyl-2-methylpiperazin-1-yl]-N,6-dimethylpyridine-2-carboximidate |
| SMILES | C=C(NCC)O/C(=N\C)c1ccc(N2C[C@H](CC)N(C3CCN(C(=C)c4ccc(Cl)cc4)CC3)C[C@H]2C)c(C)n1 |
| InChI | InChI=1S/C32H45ClN6O/c1-8-28-21-38(31-15-14-30(36-23(31)4)32(34-7)40-25(6)35-9-2)22(3)20-39(28)29-16-18-37(19-17-29)24(5)26-10-12-27(33)13-11-26/h10-15,22,28-29,35H,5-6,8-9,16-21H2,1-4,7H3/b34-32-/t22-,28+/m1/s1 |
| InChIKey | IHTYIKKWZHETFL-CFOLFHNUSA-N |
| XLogP | 5.94 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.21 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|