About (4S)-3-ethoxy-2,4-dimethyloxolane
(4S)-3-ethoxy-2,4-dimethyloxolane (PubChem CID 89332944) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is (4S)-3-ethoxy-2,4-dimethyloxolane.
Molecular Properties
| Compound Name | (4S)-3-ethoxy-2,4-dimethyloxolane |
| PubChem CID | 89332944 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (4S)-3-ethoxy-2,4-dimethyloxolane |
| SMILES | CCOC1C(C)OC[C@@H]1C |
| InChI | InChI=1S/C8H16O2/c1-4-9-8-6(2)5-10-7(8)3/h6-8H,4-5H2,1-3H3/t6-,7?,8?/m0/s1 |
| InChIKey | QEPNBCDKWOHNQI-KKMMWDRVSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-3-ethoxy-2,4-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-ethoxy-2,4-dimethyloxolane?
The IUPAC name of (4S)-3-ethoxy-2,4-dimethyloxolane (CID 89332944) is (4S)-3-ethoxy-2,4-dimethyloxolane.
What is the SMILES notation for (4S)-3-ethoxy-2,4-dimethyloxolane?
The canonical SMILES for (4S)-3-ethoxy-2,4-dimethyloxolane is CCOC1C(C)OC[C@@H]1C.
What is the InChIKey of (4S)-3-ethoxy-2,4-dimethyloxolane?
The InChIKey is QEPNBCDKWOHNQI-KKMMWDRVSA-N. The full InChI is InChI=1S/C8H16O2/c1-4-9-8-6(2)5-10-7(8)3/h6-8H,4-5H2,1-3H3/t6-,7?,8?/m0/s1.
What are the key properties of (4S)-3-ethoxy-2,4-dimethyloxolane?
(4S)-3-ethoxy-2,4-dimethyloxolane has a molecular weight of 144.21 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-ethoxy-2,4-dimethyloxolane is sourced from PubChem (CID 89332944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).