About 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]
3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] (PubChem CID 89333123) has the molecular formula C12H22NO+
and a molecular weight of 196.31 g/mol. Its IUPAC name is 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium].
Molecular Properties
| Compound Name | 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] |
| PubChem CID | 89333123 |
| Molecular Formula | C12H22NO+ |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] |
| SMILES | COC1CC2CCC(C1)[N+]21CCCC1 |
| InChI | InChI=1S/C12H22NO/c1-14-12-8-10-4-5-11(9-12)13(10)6-2-3-7-13/h10-12H,2-9H2,1H3/q+1 |
| InChIKey | IOIYPFZDNOMUNF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]?
The IUPAC name of 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] (CID 89333123) is 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium].
What is the SMILES notation for 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]?
The canonical SMILES for 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] is COC1CC2CCC(C1)[N+]21CCCC1.
What is the InChIKey of 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]?
The InChIKey is IOIYPFZDNOMUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22NO/c1-14-12-8-10-4-5-11(9-12)13(10)6-2-3-7-13/h10-12H,2-9H2,1H3/q+1.
What are the key properties of 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]?
3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] has a molecular weight of 196.31 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyspiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium] is sourced from PubChem (CID 89333123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).