C11H21NS — CID 89333137
1,2-diethyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole (PubChem CID 89333137) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 1,2-diethyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole.
| Compound Name | 1,2-diethyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole |
|---|---|
| PubChem CID | 89333137 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1,2-diethyl-3,3a,4,5,7,7a-hexahydro-2H-thiopyrano[3,4-b]pyrrole |
| SMILES | CCC1CC2CCSCC2N1CC |
| InChI | InChI=1S/C11H21NS/c1-3-10-7-9-5-6-13-8-11(9)12(10)4-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | SPXKBMSDEPYGFC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |