About (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium (PubChem CID 8933332) has the molecular formula C17H19N4O3S+
and a molecular weight of 359.43 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium.
Molecular Properties
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium |
| PubChem CID | 8933332 |
| Molecular Formula | C17H19N4O3S+ |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium |
| SMILES | Cc1ccc2nc(C[NH2+]Cc3ccc(S(N)(=O)=O)cc3)cc(=O)n2c1 |
| InChI | InChI=1S/C17H18N4O3S/c1-12-2-7-16-20-14(8-17(22)21(16)11-12)10-19-9-13-3-5-15(6-4-13)25(18,23)24/h2-8,11,19H,9-10H2,1H3,(H2,18,23,24)/p+1 |
| InChIKey | PTGVSSPRZCGTIT-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium?
The IUPAC name of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium (CID 8933332) is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium.
What is the SMILES notation for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium?
The canonical SMILES for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium is Cc1ccc2nc(C[NH2+]Cc3ccc(S(N)(=O)=O)cc3)cc(=O)n2c1.
What is the InChIKey of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium?
The InChIKey is PTGVSSPRZCGTIT-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H18N4O3S/c1-12-2-7-16-20-14(8-17(22)21(16)11-12)10-19-9-13-3-5-15(6-4-13)25(18,23)24/h2-8,11,19H,9-10H2,1H3,(H2,18,23,24)/p+1.
What are the key properties of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium?
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium has a molecular weight of 359.43 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl-[(4-sulfamoylphenyl)methyl]azanium is sourced from PubChem (CID 8933332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).