C7H6F8 — CID 89333717
1,1,2,2,3,4,4,5-octafluoro-3,5-dimethylcyclopentane (PubChem CID 89333717) has the molecular formula C7H6F8 and a molecular weight of 242.11 g/mol. Its IUPAC name is 1,1,2,2,3,4,4,5-octafluoro-3,5-dimethylcyclopentane.
| Compound Name | 1,1,2,2,3,4,4,5-octafluoro-3,5-dimethylcyclopentane |
|---|---|
| PubChem CID | 89333717 |
| Molecular Formula | C7H6F8 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,1,2,2,3,4,4,5-octafluoro-3,5-dimethylcyclopentane |
| SMILES | CC1(F)C(F)(F)C(C)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H6F8/c1-3(8)5(10,11)4(2,9)7(14,15)6(3,12)13/h1-2H3 |
| InChIKey | GUWFBQQSXCFMAB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|