C48H36N4O12 — CID 89333832
5-[[5-[[4-(3-amino-6-iminoxanthen-9-yl)-3-carboxybenzoyl]amino]-5-carboxypentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 89333832) has the molecular formula C48H36N4O12 and a molecular weight of 860.83 g/mol. Its IUPAC name is 5-[[5-[[4-(3-amino-6-iminoxanthen-9-yl)-3-carboxybenzoyl]amino]-5-carboxypentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[5-[[4-(3-amino-6-iminoxanthen-9-yl)-3-carboxybenzoyl]amino]-5-carboxypentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89333832 |
| Molecular Formula | C48H36N4O12 |
| Molecular Weight | 860.83 g/mol |
| Exact Mass | 860.23 |
| IUPAC Name | 5-[[5-[[4-(3-amino-6-iminoxanthen-9-yl)-3-carboxybenzoyl]amino]-5-carboxypentyl]carbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | [H]/N=c1\ccc2c(-c3ccc(C(=O)NC(CCCCNC(=O)c4ccc(-c5c6ccc(=O)cc-6oc6cc(O)ccc56)c(C(=O)O)c4)C(=O)O)cc3C(=O)O)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C48H36N4O12/c49-25-6-12-31-38(19-25)63-39-20-26(50)7-13-32(39)42(31)30-11-5-24(18-36(30)47(59)60)45(56)52-37(48(61)62)3-1-2-16-51-44(55)23-4-10-29(35(17-23)46(57)58)43-33-14-8-27(53)21-40(33)64-41-22-28(54)9-15-34(41)43/h4-15,17-22,37,49,53H,1-3,16,50H2,(H,51,55)(H,52,56)(H,57,58)(H,59,60)(H,61,62)/b49-25+ |
| InChIKey | DVKNCQZVXQPFCG-ROKRGEHNSA-N |
| XLogP | 7.03 |
| TPSA | 283.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.83 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|