C10H18BIN2O2 — CID 89333892
[(1S)-3-iodo-1-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-methylideneboranyldiazene (PubChem CID 89333892) has the molecular formula C10H18BIN2O2 and a molecular weight of 335.98 g/mol. Its IUPAC name is [(1S)-3-iodo-1-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-methylideneboranyldiazene.
| Compound Name | [(1S)-3-iodo-1-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-methylideneboranyldiazene |
|---|---|
| PubChem CID | 89333892 |
| Molecular Formula | C10H18BIN2O2 |
| Molecular Weight | 335.98 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [(1S)-3-iodo-1-[(4S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-methylideneboranyldiazene |
| SMILES | C=B/N=N/[C@@H](CCI)[C@@H]1OC(C)(C)OC1C |
| InChI | InChI=1S/C10H18BIN2O2/c1-7-9(16-10(2,3)15-7)8(5-6-12)13-14-11-4/h7-9H,4-6H2,1-3H3/b14-13+/t7?,8-,9+/m0/s1 |
| InChIKey | PUDSOIWPNMJJQZ-XECQKYDXSA-N |
| XLogP | 2.22 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.98 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|