C6HF6N3 — CID 89333930
3,5-bis(1,2,2-trifluoroethenyl)-1H-1,2,4-triazole (PubChem CID 89333930) has the molecular formula C6HF6N3 and a molecular weight of 229.08 g/mol. Its IUPAC name is 3,5-bis(1,2,2-trifluoroethenyl)-1H-1,2,4-triazole.
| Compound Name | 3,5-bis(1,2,2-trifluoroethenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 89333930 |
| Molecular Formula | C6HF6N3 |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 3,5-bis(1,2,2-trifluoroethenyl)-1H-1,2,4-triazole |
| SMILES | FC(F)=C(F)c1n[nH]c(C(F)=C(F)F)n1 |
| InChI | InChI=1S/C6HF6N3/c7-1(3(9)10)5-13-6(15-14-5)2(8)4(11)12/h(H,13,14,15) |
| InChIKey | VCLZALXWKXRZSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |