C5HF6N3O — CID 89334007
3-(1,2,2-trifluoroethenoxy)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 89334007) has the molecular formula C5HF6N3O and a molecular weight of 233.07 g/mol. Its IUPAC name is 3-(1,2,2-trifluoroethenoxy)-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(1,2,2-trifluoroethenoxy)-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 89334007 |
| Molecular Formula | C5HF6N3O |
| Molecular Weight | 233.07 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 3-(1,2,2-trifluoroethenoxy)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)=C(F)Oc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C5HF6N3O/c6-1(7)2(8)15-4-12-3(13-14-4)5(9,10)11/h(H,12,13,14) |
| InChIKey | BEBAULXWTUSKPS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|