C16H16ClF2N — CID 89334160
(2S)-N-chloro-4,4-bis(3-fluorophenyl)butan-2-amine (PubChem CID 89334160) has the molecular formula C16H16ClF2N and a molecular weight of 295.76 g/mol. Its IUPAC name is (2S)-N-chloro-4,4-bis(3-fluorophenyl)butan-2-amine.
| Compound Name | (2S)-N-chloro-4,4-bis(3-fluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 89334160 |
| Molecular Formula | C16H16ClF2N |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2S)-N-chloro-4,4-bis(3-fluorophenyl)butan-2-amine |
| SMILES | C[C@@H](CC(c1cccc(F)c1)c1cccc(F)c1)NCl |
| InChI | InChI=1S/C16H16ClF2N/c1-11(20-17)8-16(12-4-2-6-14(18)9-12)13-5-3-7-15(19)10-13/h2-7,9-11,16,20H,8H2,1H3/t11-/m0/s1 |
| InChIKey | WHRNQWRSDZOKET-NSHDSACASA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|