C12H13F9O — CID 89334163
1,1,2-trifluoro-4-[3,3,3-trifluoro-2-methoxy-2-(trifluoromethyl)propyl]hepta-1,6-diene (PubChem CID 89334163) has the molecular formula C12H13F9O and a molecular weight of 344.22 g/mol. Its IUPAC name is 1,1,2-trifluoro-4-[3,3,3-trifluoro-2-methoxy-2-(trifluoromethyl)propyl]hepta-1,6-diene.
| Compound Name | 1,1,2-trifluoro-4-[3,3,3-trifluoro-2-methoxy-2-(trifluoromethyl)propyl]hepta-1,6-diene |
|---|---|
| PubChem CID | 89334163 |
| Molecular Formula | C12H13F9O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1,1,2-trifluoro-4-[3,3,3-trifluoro-2-methoxy-2-(trifluoromethyl)propyl]hepta-1,6-diene |
| SMILES | C=CCC(CC(F)=C(F)F)CC(OC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F9O/c1-3-4-7(5-8(13)9(14)15)6-10(22-2,11(16,17)18)12(19,20)21/h3,7H,1,4-6H2,2H3 |
| InChIKey | ZUCRVQUEVWQIAW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|