C13H18F6O — CID 89334167
4-(2-ethoxy-3,3,3-trifluoro-2-methylpropyl)-1,1,2-trifluorohepta-1,6-diene (PubChem CID 89334167) has the molecular formula C13H18F6O and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-(2-ethoxy-3,3,3-trifluoro-2-methylpropyl)-1,1,2-trifluorohepta-1,6-diene.
| Compound Name | 4-(2-ethoxy-3,3,3-trifluoro-2-methylpropyl)-1,1,2-trifluorohepta-1,6-diene |
|---|---|
| PubChem CID | 89334167 |
| Molecular Formula | C13H18F6O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(2-ethoxy-3,3,3-trifluoro-2-methylpropyl)-1,1,2-trifluorohepta-1,6-diene |
| SMILES | C=CCC(CC(F)=C(F)F)CC(C)(OCC)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O/c1-4-6-9(7-10(14)11(15)16)8-12(3,20-5-2)13(17,18)19/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | PGEPNEYDXHCATJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|