About 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene
4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene (PubChem CID 89334189) has the molecular formula C22H19Br
and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene.
Molecular Properties
| Compound Name | 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene |
| PubChem CID | 89334189 |
| Molecular Formula | C22H19Br |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene |
| SMILES | Brc1ccc(C2=CCC(C3=C4C=CC=CC4CC=C3)C=C2)cc1 |
| InChI | InChI=1S/C22H19Br/c23-20-14-12-17(13-15-20)16-8-10-19(11-9-16)22-7-3-5-18-4-1-2-6-21(18)22/h1-4,6-10,12-15,18-19H,5,11H2 |
| InChIKey | FLTZPSFXTARCPH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene?
The IUPAC name of 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene (CID 89334189) is 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene.
What is the SMILES notation for 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene?
The canonical SMILES for 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene is Brc1ccc(C2=CCC(C3=C4C=CC=CC4CC=C3)C=C2)cc1.
What is the InChIKey of 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene?
The InChIKey is FLTZPSFXTARCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Br/c23-20-14-12-17(13-15-20)16-8-10-19(11-9-16)22-7-3-5-18-4-1-2-6-21(18)22/h1-4,6-10,12-15,18-19H,5,11H2.
What are the key properties of 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene?
4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene has a molecular weight of 363.30 g/mol, XLogP of 6.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-bromophenyl)cyclohexa-2,4-dien-1-yl]-1,8a-dihydronaphthalene is sourced from PubChem (CID 89334189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).