C29H43NO12 — CID 89334456
methyl (3R)-3-[(R)-[5-(acetyloxymethyl)-3-benzyl-2-oxo-1,3-oxazolidin-4-yl]-methoxymethoxy]-4-butoxy-4-[(4S,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (PubChem CID 89334456) has the molecular formula C29H43NO12 and a molecular weight of 597.66 g/mol. Its IUPAC name is methyl (3R)-3-[(R)-[5-(acetyloxymethyl)-3-benzyl-2-oxo-1,3-oxazolidin-4-yl]-methoxymethoxy]-4-butoxy-4-[(4S,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate.
| Compound Name | methyl (3R)-3-[(R)-[5-(acetyloxymethyl)-3-benzyl-2-oxo-1,3-oxazolidin-4-yl]-methoxymethoxy]-4-butoxy-4-[(4S,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
|---|---|
| PubChem CID | 89334456 |
| Molecular Formula | C29H43NO12 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | methyl (3R)-3-[(R)-[5-(acetyloxymethyl)-3-benzyl-2-oxo-1,3-oxazolidin-4-yl]-methoxymethoxy]-4-butoxy-4-[(4S,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| SMILES | CCCCOC([C@@H](CC(=O)OC)O[C@@H](OC)C1C(COC(C)=O)OC(=O)N1Cc1ccccc1)[C@@H]1OC(C)(C)O[C@H]1O |
| InChI | InChI=1S/C29H43NO12/c1-7-8-14-37-24(25-26(33)42-29(3,4)41-25)20(15-22(32)35-5)39-27(36-6)23-21(17-38-18(2)31)40-28(34)30(23)16-19-12-10-9-11-13-19/h9-13,20-21,23-27,33H,7-8,14-17H2,1-6H3/t20-,21?,23?,24?,25+,26-,27-/m1/s1 |
| InChIKey | LTEUMQYUNGOQML-JZRFAIKSSA-N |
| XLogP | 2.52 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|