C23H36IN7O2 — CID 89334660
5-[[4-[3-(iodomethyl)-4-methoxyanilino]-6-[methyl-(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 89334660) has the molecular formula C23H36IN7O2 and a molecular weight of 569.49 g/mol. Its IUPAC name is 5-[[4-[3-(iodomethyl)-4-methoxyanilino]-6-[methyl-(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-[3-(iodomethyl)-4-methoxyanilino]-6-[methyl-(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 89334660 |
| Molecular Formula | C23H36IN7O2 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 5-[[4-[3-(iodomethyl)-4-methoxyanilino]-6-[methyl-(1-methylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | COc1ccc(Nc2nc(NCCCCCO)nc(N(C)C3CCN(C)CC3)n2)cc1CI |
| InChI | InChI=1S/C23H36IN7O2/c1-30-12-9-19(10-13-30)31(2)23-28-21(25-11-5-4-6-14-32)27-22(29-23)26-18-7-8-20(33-3)17(15-18)16-24/h7-8,15,19,32H,4-6,9-14,16H2,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | YVLRDSGAKNCYIE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|