C11H16N2 — CID 89334721
7,7-dimethyl-1,2,3,4-tetrahydropyrido[4,3-c]azepine (PubChem CID 89334721) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 7,7-dimethyl-1,2,3,4-tetrahydropyrido[4,3-c]azepine.
| Compound Name | 7,7-dimethyl-1,2,3,4-tetrahydropyrido[4,3-c]azepine |
|---|---|
| PubChem CID | 89334721 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 7,7-dimethyl-1,2,3,4-tetrahydropyrido[4,3-c]azepine |
| SMILES | CC1(C)C=CC2=C(C=N1)CCNC2 |
| InChI | InChI=1S/C11H16N2/c1-11(2)5-3-9-7-12-6-4-10(9)8-13-11/h3,5,8,12H,4,6-7H2,1-2H3 |
| InChIKey | ZEGCDARWGIXQCL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |