About (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine
(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 89335536) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine |
| PubChem CID | 89335536 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C=C\C=C(/C)CN |
| InChI | InChI=1S/C7H12N2/c1-7(6-8)4-3-5-9-2/h3-5H,2,6,8H2,1H3/b5-3-,7-4+ |
| InChIKey | QRNQBWWJIASSDO-XKSOLRDRSA-N |
| XLogP | 1.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine?
The IUPAC name of (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine (CID 89335536) is (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine.
What is the SMILES notation for (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine?
The canonical SMILES for (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine is C=N/C=C\C=C(/C)CN.
What is the InChIKey of (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine?
The InChIKey is QRNQBWWJIASSDO-XKSOLRDRSA-N. The full InChI is InChI=1S/C7H12N2/c1-7(6-8)4-3-5-9-2/h3-5H,2,6,8H2,1H3/b5-3-,7-4+.
What are the key properties of (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine?
(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine has a molecular weight of 124.19 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dien-1-amine is sourced from PubChem (CID 89335536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).