C17H36O2 — CID 89335583
4,7-dimethylpentadecane-4,7-diol (PubChem CID 89335583) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is 4,7-dimethylpentadecane-4,7-diol.
| Compound Name | 4,7-dimethylpentadecane-4,7-diol |
|---|---|
| PubChem CID | 89335583 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 4,7-dimethylpentadecane-4,7-diol |
| SMILES | CCCCCCCCC(C)(O)CCC(C)(O)CCC |
| InChI | InChI=1S/C17H36O2/c1-5-7-8-9-10-11-13-17(4,19)15-14-16(3,18)12-6-2/h18-19H,5-15H2,1-4H3 |
| InChIKey | RCJKOZDTQPRYEK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|