About 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine
1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine (PubChem CID 89335604) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine.
Molecular Properties
| Compound Name | 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine |
| PubChem CID | 89335604 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine |
| SMILES | CNC1CC(NC)CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C11H25N3/c1-11(2,3)14-7-9(12-4)6-10(8-14)13-5/h9-10,12-13H,6-8H2,1-5H3 |
| InChIKey | UJTLPHBPWGVUDG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine?
The IUPAC name of 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine (CID 89335604) is 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine.
What is the SMILES notation for 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine?
The canonical SMILES for 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine is CNC1CC(NC)CN(C(C)(C)C)C1.
What is the InChIKey of 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine?
The InChIKey is UJTLPHBPWGVUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3/c1-11(2,3)14-7-9(12-4)6-10(8-14)13-5/h9-10,12-13H,6-8H2,1-5H3.
What are the key properties of 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine?
1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine has a molecular weight of 199.34 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-N,5-N-dimethylpiperidine-3,5-diamine is sourced from PubChem (CID 89335604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).