About 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene
2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene (PubChem CID 89335898) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 89335898 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene |
| SMILES | C=CC1=C(SC(C)C)CC(OC)C(OC)=C1 |
| InChI | InChI=1S/C13H20O2S/c1-6-10-7-11(14-4)12(15-5)8-13(10)16-9(2)3/h6-7,9,12H,1,8H2,2-5H3 |
| InChIKey | WNWGRKKGIOAXRH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene (CID 89335898) is 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene is C=CC1=C(SC(C)C)CC(OC)C(OC)=C1.
What is the InChIKey of 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene?
The InChIKey is WNWGRKKGIOAXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-6-10-7-11(14-4)12(15-5)8-13(10)16-9(2)3/h6-7,9,12H,1,8H2,2-5H3.
What are the key properties of 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene?
2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene has a molecular weight of 240.37 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-4,5-dimethoxy-1-propan-2-ylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 89335898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).