C29H30F6N4O3 — CID 89335908
2-[5-[3-[[2,4-bis(trifluoromethyl)phenyl]methyl-(5-ethylpyrimidin-2-yl)amino]propoxy]-1-methyl-2,3-dihydroindol-3-yl]acetic acid (PubChem CID 89335908) has the molecular formula C29H30F6N4O3 and a molecular weight of 596.57 g/mol. Its IUPAC name is 2-[5-[3-[[2,4-bis(trifluoromethyl)phenyl]methyl-(5-ethylpyrimidin-2-yl)amino]propoxy]-1-methyl-2,3-dihydroindol-3-yl]acetic acid.
| Compound Name | 2-[5-[3-[[2,4-bis(trifluoromethyl)phenyl]methyl-(5-ethylpyrimidin-2-yl)amino]propoxy]-1-methyl-2,3-dihydroindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 89335908 |
| Molecular Formula | C29H30F6N4O3 |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-[5-[3-[[2,4-bis(trifluoromethyl)phenyl]methyl-(5-ethylpyrimidin-2-yl)amino]propoxy]-1-methyl-2,3-dihydroindol-3-yl]acetic acid |
| SMILES | CCc1cnc(N(CCCOc2ccc3c(c2)C(CC(=O)O)CN3C)Cc2ccc(C(F)(F)F)cc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C29H30F6N4O3/c1-3-18-14-36-27(37-15-18)39(17-19-5-6-21(28(30,31)32)12-24(19)29(33,34)35)9-4-10-42-22-7-8-25-23(13-22)20(11-26(40)41)16-38(25)2/h5-8,12-15,20H,3-4,9-11,16-17H2,1-2H3,(H,40,41) |
| InChIKey | PBNBUWMIBDSRNW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|