C28H42N2 — CID 89335914
3-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1-N,2-N,4-trimethyl-6-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 89335914) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1-N,2-N,4-trimethyl-6-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1-N,2-N,4-trimethyl-6-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 89335914 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 3-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1-N,2-N,4-trimethyl-6-[(2E,4E)-5,6,6-trimethylhepta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1/C(/C(C)=C/C=C(\C)C(C)C)=C(C)C=C(/C(C)=C/C=C(\C)C(C)(C)C)/C1=N\C |
| InChI | InChI=1S/C28H42N2/c1-18(2)19(3)13-14-21(5)25-22(6)17-24(26(29-11)27(25)30-12)20(4)15-16-23(7)28(8,9)10/h13-18H,1-12H3/b19-13+,20-15+,21-14+,23-16+,29-26+,30-27- |
| InChIKey | DLRYOCZQKFDMTC-VZOBGIHASA-N |
| XLogP | 7.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|