C25H30F3N5O12S3 — CID 89336060
[(2R)-2-(6-benzamidopurin-9-yl)-4-butoxy-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 89336060) has the molecular formula C25H30F3N5O12S3 and a molecular weight of 745.73 g/mol. Its IUPAC name is [(2R)-2-(6-benzamidopurin-9-yl)-4-butoxy-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R)-2-(6-benzamidopurin-9-yl)-4-butoxy-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89336060 |
| Molecular Formula | C25H30F3N5O12S3 |
| Molecular Weight | 745.73 g/mol |
| Exact Mass | 745.10 |
| IUPAC Name | [(2R)-2-(6-benzamidopurin-9-yl)-4-butoxy-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CCCCOC1C(OS(=O)(=O)C(F)(F)F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)OC1(COS(C)(=O)=O)COS(C)(=O)=O |
| InChI | InChI=1S/C25H30F3N5O12S3/c1-4-5-11-41-19-18(45-48(39,40)25(26,27)28)23(44-24(19,12-42-46(2,35)36)13-43-47(3,37)38)33-15-31-17-20(29-14-30-21(17)33)32-22(34)16-9-7-6-8-10-16/h6-10,14-15,18-19,23H,4-5,11-13H2,1-3H3,(H,29,30,32,34)/t18?,19?,23-/m1/s1 |
| InChIKey | CHTSEYCFFAUKIZ-MTNXOHHFSA-N |
| XLogP | 1.72 |
| TPSA | 221.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|