C24H31NO — CID 89336103
(3E,4S)-3-ethylidene-4-methyl-1-[[(3Z,5Z)-4-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]hepta-1,3,5-trien-3-yl]amino]hexan-2-one (PubChem CID 89336103) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (3E,4S)-3-ethylidene-4-methyl-1-[[(3Z,5Z)-4-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]hepta-1,3,5-trien-3-yl]amino]hexan-2-one.
| Compound Name | (3E,4S)-3-ethylidene-4-methyl-1-[[(3Z,5Z)-4-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]hepta-1,3,5-trien-3-yl]amino]hexan-2-one |
|---|---|
| PubChem CID | 89336103 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (3E,4S)-3-ethylidene-4-methyl-1-[[(3Z,5Z)-4-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]hepta-1,3,5-trien-3-yl]amino]hexan-2-one |
| SMILES | C=C/C(NCC(=O)/C(=C/C)[C@@H](C)CC)=C(\C=C/C)/C=c1/ccccc1=C |
| InChI | InChI=1S/C24H31NO/c1-7-13-21(16-20-15-12-11-14-19(20)6)23(10-4)25-17-24(26)22(9-3)18(5)8-2/h7,9-16,18,25H,4,6,8,17H2,1-3,5H3/b13-7-,20-16-,22-9+,23-21-/t18-/m0/s1 |
| InChIKey | IKLUFPOMTQWRRM-NPPQTSJVSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|