C34H16Br2N2O2 — CID 89336176
7,24-dibromo-3,20-diazanonacyclo[17.15.1.12,10.04,9.011,16.021,26.027,35.028,33.018,36]hexatriaconta-1,4(9),5,7,10(36),11,13,15,18,21(26),22,24,27(35),28,30,32-hexadecaene-17,34-dione (PubChem CID 89336176) has the molecular formula C34H16Br2N2O2 and a molecular weight of 644.32 g/mol. Its IUPAC name is 7,24-dibromo-3,20-diazanonacyclo[17.15.1.12,10.04,9.011,16.021,26.027,35.028,33.018,36]hexatriaconta-1,4(9),5,7,10(36),11,13,15,18,21(26),22,24,27(35),28,30,32-hexadecaene-17,34-dione.
| Compound Name | 7,24-dibromo-3,20-diazanonacyclo[17.15.1.12,10.04,9.011,16.021,26.027,35.028,33.018,36]hexatriaconta-1,4(9),5,7,10(36),11,13,15,18,21(26),22,24,27(35),28,30,32-hexadecaene-17,34-dione |
|---|---|
| PubChem CID | 89336176 |
| Molecular Formula | C34H16Br2N2O2 |
| Molecular Weight | 644.32 g/mol |
| Exact Mass | 641.96 |
| IUPAC Name | 7,24-dibromo-3,20-diazanonacyclo[17.15.1.12,10.04,9.011,16.021,26.027,35.028,33.018,36]hexatriaconta-1,4(9),5,7,10(36),11,13,15,18,21(26),22,24,27(35),28,30,32-hexadecaene-17,34-dione |
| SMILES | O=c1c2ccccc2c2c3cc(Br)ccc3[nH]c3c4c(=O)c5ccccc5c5c6cc(Br)ccc6[nH]c(c1c32)c45 |
| InChI | InChI=1S/C34H16Br2N2O2/c35-15-9-11-23-21(13-15)25-17-5-1-3-7-19(17)33(39)29-27(25)31(37-23)30-28-26(18-6-2-4-8-20(18)34(30)40)22-14-16(36)10-12-24(22)38-32(28)29/h1-14,37-38H |
| InChIKey | GTXKYIIMURKOJK-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.32 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|