C13H21N — CID 89336328
(2E,4E,7Z,9Z)-5-ethylundeca-2,4,7,9-tetraen-3-amine (PubChem CID 89336328) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2E,4E,7Z,9Z)-5-ethylundeca-2,4,7,9-tetraen-3-amine.
| Compound Name | (2E,4E,7Z,9Z)-5-ethylundeca-2,4,7,9-tetraen-3-amine |
|---|---|
| PubChem CID | 89336328 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2E,4E,7Z,9Z)-5-ethylundeca-2,4,7,9-tetraen-3-amine |
| SMILES | C/C=C\C=C/C/C(=C/C(N)=C\C)CC |
| InChI | InChI=1S/C13H21N/c1-4-7-8-9-10-12(5-2)11-13(14)6-3/h4,6-9,11H,5,10,14H2,1-3H3/b7-4-,9-8-,12-11+,13-6+ |
| InChIKey | XVOFKDDMWNFPIA-QEZBQFARSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|