C22H22N8 — CID 89336343
4-N-[3-[3-[(1-cyclopropylethenylamino)methyl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]benzene-1,4-diamine (PubChem CID 89336343) has the molecular formula C22H22N8 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-N-[3-[3-[(1-cyclopropylethenylamino)methyl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[3-[3-[(1-cyclopropylethenylamino)methyl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89336343 |
| Molecular Formula | C22H22N8 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-N-[3-[3-[(1-cyclopropylethenylamino)methyl]phenyl]triazolo[4,5-d]pyrimidin-5-yl]benzene-1,4-diamine |
| SMILES | C=C(NCc1cccc(-n2nnc3cnc(Nc4ccc(N)cc4)nc32)c1)C1CC1 |
| InChI | InChI=1S/C22H22N8/c1-14(16-5-6-16)24-12-15-3-2-4-19(11-15)30-21-20(28-29-30)13-25-22(27-21)26-18-9-7-17(23)8-10-18/h2-4,7-11,13,16,24H,1,5-6,12,23H2,(H,25,26,27) |
| InChIKey | KPOUUHHWNOLXRF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|