About 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one
4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one (PubChem CID 89336628) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one |
| PubChem CID | 89336628 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one |
| SMILES | C=C1NC(=O)CC1C1=CC=CCC1 |
| InChI | InChI=1S/C11H13NO/c1-8-10(7-11(13)12-8)9-5-3-2-4-6-9/h2-3,5,10H,1,4,6-7H2,(H,12,13) |
| InChIKey | NPNRQVKSEPHUDQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one?
The IUPAC name of 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one (CID 89336628) is 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one.
What is the SMILES notation for 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one?
The canonical SMILES for 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one is C=C1NC(=O)CC1C1=CC=CCC1.
What is the InChIKey of 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one?
The InChIKey is NPNRQVKSEPHUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-8-10(7-11(13)12-8)9-5-3-2-4-6-9/h2-3,5,10H,1,4,6-7H2,(H,12,13).
What are the key properties of 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one?
4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one has a molecular weight of 175.23 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,3-dien-1-yl-5-methylidenepyrrolidin-2-one is sourced from PubChem (CID 89336628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).