About 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol
2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol (PubChem CID 89336745) has the molecular formula C8H9N2OS+
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol.
Molecular Properties
| Compound Name | 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol |
| PubChem CID | 89336745 |
| Molecular Formula | C8H9N2OS+ |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol |
| SMILES | C[n+]1c(N)sc2cc(O)ccc21 |
| InChI | InChI=1S/C8H8N2OS/c1-10-6-3-2-5(11)4-7(6)12-8(10)9/h2-4,9,11H,1H3/p+1 |
| InChIKey | CGKRXCQPPNZADF-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 50.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol?
The IUPAC name of 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol (CID 89336745) is 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol.
What is the SMILES notation for 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol?
The canonical SMILES for 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol is C[n+]1c(N)sc2cc(O)ccc21.
What is the InChIKey of 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol?
The InChIKey is CGKRXCQPPNZADF-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8N2OS/c1-10-6-3-2-5(11)4-7(6)12-8(10)9/h2-4,9,11H,1H3/p+1.
What are the key properties of 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol?
2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol has a molecular weight of 181.24 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-1,3-benzothiazol-3-ium-6-ol is sourced from PubChem (CID 89336745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).