About (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine
(2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine (PubChem CID 89336808) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine |
| PubChem CID | 89336808 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine |
| SMILES | C=C(/C=C(/C)N)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H22N2/c1-9-5-10(2)8-14(7-9)12(4)6-11(3)13/h6,9-10H,4-5,7-8,13H2,1-3H3/b11-6- |
| InChIKey | KKQKCNPPNJBCQC-WDZFZDKYSA-N |
| XLogP | 2.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine?
The IUPAC name of (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine (CID 89336808) is (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine.
What is the SMILES notation for (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine?
The canonical SMILES for (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine is C=C(/C=C(/C)N)N1CC(C)CC(C)C1.
What is the InChIKey of (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine?
The InChIKey is KKQKCNPPNJBCQC-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H22N2/c1-9-5-10(2)8-14(7-9)12(4)6-11(3)13/h6,9-10H,4-5,7-8,13H2,1-3H3/b11-6-.
What are the key properties of (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine?
(2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine has a molecular weight of 194.32 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-4-(3,5-dimethylpiperidin-1-yl)penta-2,4-dien-2-amine is sourced from PubChem (CID 89336808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).