About N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide
N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide (PubChem CID 89336887) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide |
| PubChem CID | 89336887 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide |
| SMILES | C=C/C=C\N=C(/N)N1CCN(C)CC1 |
| InChI | InChI=1S/C10H18N4/c1-3-4-5-12-10(11)14-8-6-13(2)7-9-14/h3-5H,1,6-9H2,2H3,(H2,11,12)/b5-4- |
| InChIKey | STPPHMNBJXTFNA-PLNGDYQASA-N |
| XLogP | 0.25 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide?
The IUPAC name of N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide (CID 89336887) is N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide.
What is the SMILES notation for N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide?
The canonical SMILES for N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide is C=C/C=C\N=C(/N)N1CCN(C)CC1.
What is the InChIKey of N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide?
The InChIKey is STPPHMNBJXTFNA-PLNGDYQASA-N. The full InChI is InChI=1S/C10H18N4/c1-3-4-5-12-10(11)14-8-6-13(2)7-9-14/h3-5H,1,6-9H2,2H3,(H2,11,12)/b5-4-.
What are the key properties of N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide?
N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide has a molecular weight of 194.28 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1Z)-buta-1,3-dienyl]-4-methylpiperazine-1-carboximidamide is sourced from PubChem (CID 89336887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).