C9H14N2 — CID 89337028
(4E,8E)-2,7-dimethyl-6,7-dihydro-1H-1,3-diazonine (PubChem CID 89337028) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (4E,8E)-2,7-dimethyl-6,7-dihydro-1H-1,3-diazonine.
| Compound Name | (4E,8E)-2,7-dimethyl-6,7-dihydro-1H-1,3-diazonine |
|---|---|
| PubChem CID | 89337028 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (4E,8E)-2,7-dimethyl-6,7-dihydro-1H-1,3-diazonine |
| SMILES | C/C1=N/C=C/CC(C)/C=C/N1 |
| InChI | InChI=1S/C9H14N2/c1-8-4-3-6-10-9(2)11-7-5-8/h3,5-8H,4H2,1-2H3,(H,10,11)/b6-3+,7-5+ |
| InChIKey | SJOKAWKSBZQKKE-SNCPXTGUSA-N |
| XLogP | 2.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |